C20H29N — CID 28528182
7-methyl-N-(naphthalen-1-ylmethyl)octan-1-amine (PubChem CID 28528182) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 7-methyl-N-(naphthalen-1-ylmethyl)octan-1-amine.
| Compound Name | 7-methyl-N-(naphthalen-1-ylmethyl)octan-1-amine |
|---|---|
| PubChem CID | 28528182 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 7-methyl-N-(naphthalen-1-ylmethyl)octan-1-amine |
| SMILES | CC(C)CCCCCCNCc1cccc2ccccc12 |
| InChI | InChI=1S/C20H29N/c1-17(2)10-5-3-4-8-15-21-16-19-13-9-12-18-11-6-7-14-20(18)19/h6-7,9,11-14,17,21H,3-5,8,10,15-16H2,1-2H3 |
| InChIKey | XKCXRYHROXCCFN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|