C15H20N2 — CID 4720020
N-methyl-N'-(naphthalen-1-ylmethyl)propane-1,3-diamine (PubChem CID 4720020) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-methyl-N'-(naphthalen-1-ylmethyl)propane-1,3-diamine.
| Compound Name | N-methyl-N'-(naphthalen-1-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 4720020 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | N-methyl-N'-(naphthalen-1-ylmethyl)propane-1,3-diamine |
| SMILES | CNCCCNCc1cccc2ccccc12 |
| InChI | InChI=1S/C15H20N2/c1-16-10-5-11-17-12-14-8-4-7-13-6-2-3-9-15(13)14/h2-4,6-9,16-17H,5,10-12H2,1H3 |
| InChIKey | UEMRMBZEACOTEH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|