C15H17N — CID 59694789
CID 59694789 (PubChem CID 59694789) has the molecular formula C15H17N and a molecular weight of 211.31 g/mol.
| Compound Name | CID 59694789 |
|---|---|
| PubChem CID | 59694789 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | — |
| SMILES | [CH]CCCNCc1cccc2ccccc12 |
| InChI | InChI=1S/C15H17N/c1-2-3-11-16-12-14-9-6-8-13-7-4-5-10-15(13)14/h1,4-10,16H,2-3,11-12H2 |
| InChIKey | PZKHPIFYBIYIGA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|