C26H25ClN2O2S — CID 28530620
3-[3-(4-chlorophenoxy)propyl]-2-(3-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 28530620) has the molecular formula C26H25ClN2O2S and a molecular weight of 465.02 g/mol. Its IUPAC name is 3-[3-(4-chlorophenoxy)propyl]-2-(3-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[3-(4-chlorophenoxy)propyl]-2-(3-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 28530620 |
| Molecular Formula | C26H25ClN2O2S |
| Molecular Weight | 465.02 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 3-[3-(4-chlorophenoxy)propyl]-2-(3-methylphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | Cc1cccc(-c2nc3sc4c(c3c(=O)n2CCCOc2ccc(Cl)cc2)CCCC4)c1 |
| InChI | InChI=1S/C26H25ClN2O2S/c1-17-6-4-7-18(16-17)24-28-25-23(21-8-2-3-9-22(21)32-25)26(30)29(24)14-5-15-31-20-12-10-19(27)11-13-20/h4,6-7,10-13,16H,2-3,5,8-9,14-15H2,1H3 |
| InChIKey | TXFAILHGOOXXBH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.02 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|