C28H29N3O2S — CID 28529814
2-[2-(3-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 28529814) has the molecular formula C28H29N3O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is 2-[2-(3-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[2-(3-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 28529814 |
| Molecular Formula | C28H29N3O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 2-[2-(3-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cccc(-c2nc3sc4c(c3c(=O)n2CC(=O)Nc2c(C)cc(C)cc2C)CCCC4)c1 |
| InChI | InChI=1S/C28H29N3O2S/c1-16-8-7-9-20(14-16)26-30-27-24(21-10-5-6-11-22(21)34-27)28(33)31(26)15-23(32)29-25-18(3)12-17(2)13-19(25)4/h7-9,12-14H,5-6,10-11,15H2,1-4H3,(H,29,32) |
| InChIKey | MZCXMDBFDCKADM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |