C26H25N3O2S — CID 28528800
N-(2,5-dimethylphenyl)-2-(4-oxo-2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide (PubChem CID 28528800) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(4-oxo-2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(4-oxo-2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide |
|---|---|
| PubChem CID | 28528800 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(4-oxo-2-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)Cn2c(-c3ccccc3)nc3sc4c(c3c2=O)CCCC4)c1 |
| InChI | InChI=1S/C26H25N3O2S/c1-16-12-13-17(2)20(14-16)27-22(30)15-29-24(18-8-4-3-5-9-18)28-25-23(26(29)31)19-10-6-7-11-21(19)32-25/h3-5,8-9,12-14H,6-7,10-11,15H2,1-2H3,(H,27,30) |
| InChIKey | HEWWXSSPZASJGY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |