C27H27N3O3S — CID 3370452
N-(2,4-dimethylphenyl)-2-[2-(3-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 3370452) has the molecular formula C27H27N3O3S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[2-(3-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[2-(3-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3370452 |
| Molecular Formula | C27H27N3O3S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[2-(3-methoxyphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | COc1cccc(-c2nc3sc4c(c3c(=O)n2CC(=O)Nc2ccc(C)cc2C)CCCC4)c1 |
| InChI | InChI=1S/C27H27N3O3S/c1-16-11-12-21(17(2)13-16)28-23(31)15-30-25(18-7-6-8-19(14-18)33-3)29-26-24(27(30)32)20-9-4-5-10-22(20)34-26/h6-8,11-14H,4-5,9-10,15H2,1-3H3,(H,28,31) |
| InChIKey | MNOGYTDFFWRJOE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |