C20H18N4O3 — CID 2853421
2-(furan-2-ylmethylamino)-3-(furan-2-ylmethyliminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 2853421) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)-3-(furan-2-ylmethyliminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(furan-2-ylmethylamino)-3-(furan-2-ylmethyliminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 2853421 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-(furan-2-ylmethylamino)-3-(furan-2-ylmethyliminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)c(/C=N/Cc3ccco3)c(NCc3ccco3)nc12 |
| InChI | InChI=1S/C20H18N4O3/c1-14-5-2-8-24-19(14)23-18(22-12-16-7-4-10-27-16)17(20(24)25)13-21-11-15-6-3-9-26-15/h2-10,13,22H,11-12H2,1H3/b21-13+ |
| InChIKey | DJPAXCSZPONJTD-FYJGNVAPSA-N |
| XLogP | 3.42 |
| TPSA | 85.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|