C19H22N4O2 — CID 2324129
3-[[(2S)-butan-2-yl]iminomethyl]-2-(furan-2-ylmethylamino)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 2324129) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[[(2S)-butan-2-yl]iminomethyl]-2-(furan-2-ylmethylamino)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[[(2S)-butan-2-yl]iminomethyl]-2-(furan-2-ylmethylamino)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 2324129 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-[[(2S)-butan-2-yl]iminomethyl]-2-(furan-2-ylmethylamino)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC[C@H](C)/N=C/c1c(NCc2ccco2)nc2c(C)cccn2c1=O |
| InChI | InChI=1S/C19H22N4O2/c1-4-14(3)20-12-16-17(21-11-15-8-6-10-25-15)22-18-13(2)7-5-9-23(18)19(16)24/h5-10,12,14,21H,4,11H2,1-3H3/b20-12+/t14-/m0/s1 |
| InChIKey | WUPHGRKJEJGDKR-PVGUKEHMSA-N |
| XLogP | 3.43 |
| TPSA | 71.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|