C20H21ClN4O — CID 21237341
3-(butan-2-yliminomethyl)-2-(3-chloroanilino)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 21237341) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 3-(butan-2-yliminomethyl)-2-(3-chloroanilino)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-(butan-2-yliminomethyl)-2-(3-chloroanilino)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 21237341 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-(butan-2-yliminomethyl)-2-(3-chloroanilino)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCC(C)/N=C/c1c(Nc2cccc(Cl)c2)nc2c(C)cccn2c1=O |
| InChI | InChI=1S/C20H21ClN4O/c1-4-14(3)22-12-17-18(23-16-9-5-8-15(21)11-16)24-19-13(2)7-6-10-25(19)20(17)26/h5-12,14,23H,4H2,1-3H3/b22-12+ |
| InChIKey | YKQAKDUVSZEZQE-WSDLNYQXSA-N |
| XLogP | 4.62 |
| TPSA | 58.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|