C16H13ClN3O2+ — CID 163765969
[3-[(3-formyl-9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]phenyl]chloranium (PubChem CID 163765969) has the molecular formula C16H13ClN3O2+ and a molecular weight of 314.75 g/mol. Its IUPAC name is [3-[(3-formyl-9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]phenyl]chloranium.
| Compound Name | [3-[(3-formyl-9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]phenyl]chloranium |
|---|---|
| PubChem CID | 163765969 |
| Molecular Formula | C16H13ClN3O2+ |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | [3-[(3-formyl-9-methyl-4-oxopyrido[1,2-a]pyrimidin-2-yl)amino]phenyl]chloranium |
| SMILES | Cc1cccn2c(=O)c(C=O)c(Nc3cccc([ClH+])c3)nc12 |
| InChI | InChI=1S/C16H12ClN3O2/c1-10-4-3-7-20-15(10)19-14(13(9-21)16(20)22)18-12-6-2-5-11(17)8-12/h2-9,17H,1H3/p+1 |
| InChIKey | MCHXPQSHFQBGDB-UHFFFAOYSA-O |
| XLogP | 2.26 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|