C18H16N2O3 — CID 45128394
2-(3,5-dimethylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde (PubChem CID 45128394) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-(3,5-dimethylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde.
| Compound Name | 2-(3,5-dimethylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
|---|---|
| PubChem CID | 45128394 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-(3,5-dimethylphenoxy)-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carbaldehyde |
| SMILES | Cc1cc(C)cc(Oc2nc3c(C)cccn3c(=O)c2C=O)c1 |
| InChI | InChI=1S/C18H16N2O3/c1-11-7-12(2)9-14(8-11)23-17-15(10-21)18(22)20-6-4-5-13(3)16(20)19-17/h4-10H,1-3H3 |
| InChIKey | HSKKESQMNVYUQD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|