C16H12N4O5 — CID 58357430
9-methyl-2-(3-nitroanilino)-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid (PubChem CID 58357430) has the molecular formula C16H12N4O5 and a molecular weight of 340.30 g/mol. Its IUPAC name is 9-methyl-2-(3-nitroanilino)-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid.
| Compound Name | 9-methyl-2-(3-nitroanilino)-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58357430 |
| Molecular Formula | C16H12N4O5 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 9-methyl-2-(3-nitroanilino)-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid |
| SMILES | Cc1cccn2c(=O)c(C(=O)O)c(Nc3cccc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C16H12N4O5/c1-9-4-3-7-19-14(9)18-13(12(15(19)21)16(22)23)17-10-5-2-6-11(8-10)20(24)25/h2-8,17H,1H3,(H,22,23) |
| InChIKey | ZJCYNRHKEQDBGB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|