C19H18FN3O5 — CID 90290579
2-[2-[4-(fluoromethoxy)phenoxy]ethylamino]-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid (PubChem CID 90290579) has the molecular formula C19H18FN3O5 and a molecular weight of 387.37 g/mol. Its IUPAC name is 2-[2-[4-(fluoromethoxy)phenoxy]ethylamino]-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid.
| Compound Name | 2-[2-[4-(fluoromethoxy)phenoxy]ethylamino]-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 90290579 |
| Molecular Formula | C19H18FN3O5 |
| Molecular Weight | 387.37 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 2-[2-[4-(fluoromethoxy)phenoxy]ethylamino]-9-methyl-4-oxopyrido[1,2-a]pyrimidine-3-carboxylic acid |
| SMILES | Cc1cccn2c(=O)c(C(=O)O)c(NCCOc3ccc(OCF)cc3)nc12 |
| InChI | InChI=1S/C19H18FN3O5/c1-12-3-2-9-23-17(12)22-16(15(18(23)24)19(25)26)21-8-10-27-13-4-6-14(7-5-13)28-11-20/h2-7,9,21H,8,10-11H2,1H3,(H,25,26) |
| InChIKey | QARXKHZVYXVEFK-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.37 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|