C9H7N3O4 — CID 112547843
8-methyl-3-nitroimidazo[1,2-a]pyridine-2-carboxylic acid (PubChem CID 112547843) has the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. Its IUPAC name is 8-methyl-3-nitroimidazo[1,2-a]pyridine-2-carboxylic acid.
| Compound Name | 8-methyl-3-nitroimidazo[1,2-a]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 112547843 |
| Molecular Formula | C9H7N3O4 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 8-methyl-3-nitroimidazo[1,2-a]pyridine-2-carboxylic acid |
| SMILES | Cc1cccn2c([N+](=O)[O-])c(C(=O)O)nc12 |
| InChI | InChI=1S/C9H7N3O4/c1-5-3-2-4-11-7(5)10-6(9(13)14)8(11)12(15)16/h2-4H,1H3,(H,13,14) |
| InChIKey | BUGPAMANCDRQMO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|