C10H9N3O4 — CID 83841739
2-ethyl-3-nitroimidazo[1,2-a]pyridine-8-carboxylic acid (PubChem CID 83841739) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 2-ethyl-3-nitroimidazo[1,2-a]pyridine-8-carboxylic acid.
| Compound Name | 2-ethyl-3-nitroimidazo[1,2-a]pyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 83841739 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-ethyl-3-nitroimidazo[1,2-a]pyridine-8-carboxylic acid |
| SMILES | CCc1nc2c(C(=O)O)cccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N3O4/c1-2-7-9(13(16)17)12-5-3-4-6(10(14)15)8(12)11-7/h3-5H,2H2,1H3,(H,14,15) |
| InChIKey | BZJQZICRVVMEBN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|