C17H12N3O4- — CID 7023676
(E)-3-[8-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate (PubChem CID 7023676) has the molecular formula C17H12N3O4- and a molecular weight of 322.30 g/mol. Its IUPAC name is (E)-3-[8-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate.
| Compound Name | (E)-3-[8-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 7023676 |
| Molecular Formula | C17H12N3O4- |
| Molecular Weight | 322.30 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (E)-3-[8-methyl-2-(3-nitrophenyl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoate |
| SMILES | Cc1cccn2c(/C=C/C(=O)[O-])c(-c3cccc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C17H13N3O4/c1-11-4-3-9-19-14(7-8-15(21)22)16(18-17(11)19)12-5-2-6-13(10-12)20(23)24/h2-10H,1H3,(H,21,22)/p-1/b8-7+ |
| InChIKey | IWBZHEROSCGDQL-BQYQJAHWSA-M |
| XLogP | 1.98 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|