C13H13N5O6 — CID 14761428
ethyl 8-[acetyl(nitroso)amino]-7-methyl-3-nitroimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 14761428) has the molecular formula C13H13N5O6 and a molecular weight of 335.28 g/mol. Its IUPAC name is ethyl 8-[acetyl(nitroso)amino]-7-methyl-3-nitroimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 8-[acetyl(nitroso)amino]-7-methyl-3-nitroimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 14761428 |
| Molecular Formula | C13H13N5O6 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | ethyl 8-[acetyl(nitroso)amino]-7-methyl-3-nitroimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2c(N(N=O)C(C)=O)c(C)ccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H13N5O6/c1-4-24-13(20)9-12(18(22)23)16-6-5-7(2)10(11(16)14-9)17(15-21)8(3)19/h5-6H,4H2,1-3H3 |
| InChIKey | ZJLBHZDXZYZNAV-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 136.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|