About 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate
2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate (PubChem CID 155927218) has the molecular formula C16H14N2O4
and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate.
Analyze 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate?
The IUPAC name of 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate (CID 155927218) is 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate.
What is the SMILES notation for 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate?
The canonical SMILES for 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate is CCOC(=O)c1nc2c3ccccc3ccn2c1C(=O)OC.
What is the InChIKey of 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate?
The InChIKey is NYXZDTJMXGXAFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O4/c1-3-22-15(19)12-13(16(20)21-2)18-9-8-10-6-4-5-7-11(10)14(18)17-12/h4-9H,3H2,1-2H3.
What are the key properties of 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate?
2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate has a molecular weight of 298.30 g/mol, XLogP of 2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-ethyl 3-O-methyl imidazo[2,1-a]isoquinoline-2,3-dicarboxylate is sourced from PubChem (CID 155927218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).