C15H12N2O4 — CID 137251410
ethyl 2-hydroxy-4-oxopyrimido[2,1-a]isoquinoline-3-carboxylate (PubChem CID 137251410) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-oxopyrimido[2,1-a]isoquinoline-3-carboxylate.
| Compound Name | ethyl 2-hydroxy-4-oxopyrimido[2,1-a]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 137251410 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | ethyl 2-hydroxy-4-oxopyrimido[2,1-a]isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)nc2c3ccccc3ccn2c1=O |
| InChI | InChI=1S/C15H12N2O4/c1-2-21-15(20)11-13(18)16-12-10-6-4-3-5-9(10)7-8-17(12)14(11)19/h3-8,18H,2H2,1H3 |
| InChIKey | DQMFJCZAWPJWHO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|