C18H16N2O4S — CID 1497267
ethyl 2-(3-methoxy-3-oxoprop-1-enyl)sulfanylimidazo[2,1-a]isoquinoline-3-carboxylate (PubChem CID 1497267) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is ethyl 2-(3-methoxy-3-oxoprop-1-enyl)sulfanylimidazo[2,1-a]isoquinoline-3-carboxylate.
| Compound Name | ethyl 2-(3-methoxy-3-oxoprop-1-enyl)sulfanylimidazo[2,1-a]isoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 1497267 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | ethyl 2-(3-methoxy-3-oxoprop-1-enyl)sulfanylimidazo[2,1-a]isoquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(SC=CC(=O)OC)nc2c3ccccc3ccn12 |
| InChI | InChI=1S/C18H16N2O4S/c1-3-24-18(22)15-17(25-11-9-14(21)23-2)19-16-13-7-5-4-6-12(13)8-10-20(15)16/h4-11H,3H2,1-2H3 |
| InChIKey | ZEDUKUGRDROQGB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|