C10H8IN3O4 — CID 53249809
ethyl 3-iodo-8-nitroimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 53249809) has the molecular formula C10H8IN3O4 and a molecular weight of 361.10 g/mol. Its IUPAC name is ethyl 3-iodo-8-nitroimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 3-iodo-8-nitroimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 53249809 |
| Molecular Formula | C10H8IN3O4 |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | ethyl 3-iodo-8-nitroimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2c([N+](=O)[O-])cccn2c1I |
| InChI | InChI=1S/C10H8IN3O4/c1-2-18-10(15)7-8(11)13-5-3-4-6(14(16)17)9(13)12-7/h3-5H,2H2,1H3 |
| InChIKey | JGMMEYKVWHWSSW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|