C15H20N6OS — CID 958866
[[2-[[(2R)-butan-2-yl]amino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]thiourea (PubChem CID 958866) has the molecular formula C15H20N6OS and a molecular weight of 332.43 g/mol. Its IUPAC name is [[2-[[(2R)-butan-2-yl]amino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]thiourea.
| Compound Name | [[2-[[(2R)-butan-2-yl]amino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 958866 |
| Molecular Formula | C15H20N6OS |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | [[2-[[(2R)-butan-2-yl]amino]-9-methyl-4-oxopyrido[1,2-a]pyrimidin-3-yl]methylideneamino]thiourea |
| SMILES | CC[C@@H](C)Nc1nc2c(C)cccn2c(=O)c1C=NNC(N)=S |
| InChI | InChI=1S/C15H20N6OS/c1-4-10(3)18-12-11(8-17-20-15(16)23)14(22)21-7-5-6-9(2)13(21)19-12/h5-8,10,18H,4H2,1-3H3,(H3,16,20,23)/t10-/m1/s1 |
| InChIKey | IHVNJKRCGNLWHM-SNVBAGLBSA-N |
| XLogP | 1.38 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|