C23H30N2O5S — CID 28537936
N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide (PubChem CID 28537936) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide.
| Compound Name | N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 28537936 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]-2-oxo-3,4-dihydro-1H-quinoline-6-sulfonamide |
| SMILES | CCCOc1ccc([C@H](C)NS(=O)(=O)c2ccc3c(c2)CCC(=O)N3)cc1OCCC |
| InChI | InChI=1S/C23H30N2O5S/c1-4-12-29-21-10-6-17(15-22(21)30-13-5-2)16(3)25-31(27,28)19-8-9-20-18(14-19)7-11-23(26)24-20/h6,8-10,14-16,25H,4-5,7,11-13H2,1-3H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | KOORYNAJLWUCBE-INIZCTEOSA-N |
| XLogP | 4.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |