C18H25NO4S2 — CID 9356126
N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 9356126) has the molecular formula C18H25NO4S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 9356126 |
| Molecular Formula | C18H25NO4S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[(1S)-1-(3,4-dipropoxyphenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | CCCOc1ccc([C@H](C)NS(=O)(=O)c2cccs2)cc1OCCC |
| InChI | InChI=1S/C18H25NO4S2/c1-4-10-22-16-9-8-15(13-17(16)23-11-5-2)14(3)19-25(20,21)18-7-6-12-24-18/h6-9,12-14,19H,4-5,10-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | QBYJGGFUIQJNNU-AWEZNQCLSA-N |
| XLogP | 4.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |