C20H21ClN2O5 — CID 28561396
[2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-ethoxybenzoate (PubChem CID 28561396) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-ethoxybenzoate.
| Compound Name | [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-ethoxybenzoate |
|---|---|
| PubChem CID | 28561396 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)NCC(=O)Nc2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C20H21ClN2O5/c1-3-27-15-9-7-14(8-10-15)20(26)28-12-19(25)22-11-18(24)23-17-6-4-5-16(21)13(17)2/h4-10H,3,11-12H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | KCFCCNBXVIYOAV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |