C20H20ClN3O5 — CID 28566936
[2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-acetamidobenzoate (PubChem CID 28566936) has the molecular formula C20H20ClN3O5 and a molecular weight of 417.85 g/mol. Its IUPAC name is [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-acetamidobenzoate.
| Compound Name | [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-acetamidobenzoate |
|---|---|
| PubChem CID | 28566936 |
| Molecular Formula | C20H20ClN3O5 |
| Molecular Weight | 417.85 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | [2-[[2-(3-chloro-2-methylanilino)-2-oxoethyl]amino]-2-oxoethyl] 3-acetamidobenzoate |
| SMILES | CC(=O)Nc1cccc(C(=O)OCC(=O)NCC(=O)Nc2cccc(Cl)c2C)c1 |
| InChI | InChI=1S/C20H20ClN3O5/c1-12-16(21)7-4-8-17(12)24-18(26)10-22-19(27)11-29-20(28)14-5-3-6-15(9-14)23-13(2)25/h3-9H,10-11H2,1-2H3,(H,22,27)(H,23,25)(H,24,26) |
| InChIKey | GOWGGCJMEBGROY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.85 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |