C22H27NO2 — CID 28566521
(2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-naphthalen-2-yloxybutanamide (PubChem CID 28566521) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-naphthalen-2-yloxybutanamide.
| Compound Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-naphthalen-2-yloxybutanamide |
|---|---|
| PubChem CID | 28566521 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | (2R)-N-[2-(cyclohexen-1-yl)ethyl]-2-naphthalen-2-yloxybutanamide |
| SMILES | CC[C@@H](Oc1ccc2ccccc2c1)C(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C22H27NO2/c1-2-21(22(24)23-15-14-17-8-4-3-5-9-17)25-20-13-12-18-10-6-7-11-19(18)16-20/h6-8,10-13,16,21H,2-5,9,14-15H2,1H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | CHOYQBOSSYVQBD-OAQYLSRUSA-N |
| XLogP | 5.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|