C22H28N2O4 — CID 28579202
N-[(2S)-butan-2-yl]-2-[3-(3,4-dimethoxyphenyl)propanoylamino]benzamide (PubChem CID 28579202) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[(2S)-butan-2-yl]-2-[3-(3,4-dimethoxyphenyl)propanoylamino]benzamide.
| Compound Name | N-[(2S)-butan-2-yl]-2-[3-(3,4-dimethoxyphenyl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 28579202 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[(2S)-butan-2-yl]-2-[3-(3,4-dimethoxyphenyl)propanoylamino]benzamide |
| SMILES | CC[C@H](C)NC(=O)c1ccccc1NC(=O)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-5-15(2)23-22(26)17-8-6-7-9-18(17)24-21(25)13-11-16-10-12-19(27-3)20(14-16)28-4/h6-10,12,14-15H,5,11,13H2,1-4H3,(H,23,26)(H,24,25)/t15-/m0/s1 |
| InChIKey | PPASKPBTPLAEFR-HNNXBMFYSA-N |
| XLogP | 3.80 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |