C22H28N2O2 — CID 133235466
N-butan-2-yl-2-[3-(3,4-dimethylphenyl)propanoylamino]benzamide (PubChem CID 133235466) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-butan-2-yl-2-[3-(3,4-dimethylphenyl)propanoylamino]benzamide.
| Compound Name | N-butan-2-yl-2-[3-(3,4-dimethylphenyl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 133235466 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-butan-2-yl-2-[3-(3,4-dimethylphenyl)propanoylamino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)CCc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-5-17(4)23-22(26)19-8-6-7-9-20(19)24-21(25)13-12-18-11-10-15(2)16(3)14-18/h6-11,14,17H,5,12-13H2,1-4H3,(H,23,26)(H,24,25) |
| InChIKey | WSGUDXYKMYVPGO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |