C16H16N2 — CID 28585691
2-[(2,3-dimethylanilino)methyl]benzonitrile (PubChem CID 28585691) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-[(2,3-dimethylanilino)methyl]benzonitrile.
| Compound Name | 2-[(2,3-dimethylanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 28585691 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(2,3-dimethylanilino)methyl]benzonitrile |
| SMILES | Cc1cccc(NCc2ccccc2C#N)c1C |
| InChI | InChI=1S/C16H16N2/c1-12-6-5-9-16(13(12)2)18-11-15-8-4-3-7-14(15)10-17/h3-9,18H,11H2,1-2H3 |
| InChIKey | FRUTUOVYMOBHSF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |