C29H23N3O3S — CID 28588387
N-[(Z)-anthracen-9-ylmethylideneamino]-4-[benzenesulfonyl(methyl)amino]benzamide (PubChem CID 28588387) has the molecular formula C29H23N3O3S and a molecular weight of 493.59 g/mol. Its IUPAC name is N-[(Z)-anthracen-9-ylmethylideneamino]-4-[benzenesulfonyl(methyl)amino]benzamide.
| Compound Name | N-[(Z)-anthracen-9-ylmethylideneamino]-4-[benzenesulfonyl(methyl)amino]benzamide |
|---|---|
| PubChem CID | 28588387 |
| Molecular Formula | C29H23N3O3S |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | N-[(Z)-anthracen-9-ylmethylideneamino]-4-[benzenesulfonyl(methyl)amino]benzamide |
| SMILES | CN(c1ccc(C(=O)N/N=C\c2c3ccccc3cc3ccccc23)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H23N3O3S/c1-32(36(34,35)25-11-3-2-4-12-25)24-17-15-21(16-18-24)29(33)31-30-20-28-26-13-7-5-9-22(26)19-23-10-6-8-14-27(23)28/h2-20H,1H3,(H,31,33)/b30-20- |
| InChIKey | DLYFYYNBLJIGRM-COEJQBHMSA-N |
| XLogP | 5.58 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|