C18H20N2O3S2 — CID 28591458
4-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-prop-2-enylbenzamide (PubChem CID 28591458) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is 4-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-prop-2-enylbenzamide.
| Compound Name | 4-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 28591458 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 4-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(N(C)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-4-13-19-18(21)14-5-7-15(8-6-14)20(2)25(22,23)17-11-9-16(24-3)10-12-17/h4-12H,1,13H2,2-3H3,(H,19,21) |
| InChIKey | ABFCYFJCDLLWKA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|