C24H26N2O3S2 — CID 28633363
4-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-[(1S)-1-phenylpropyl]benzamide (PubChem CID 28633363) has the molecular formula C24H26N2O3S2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 4-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-[(1S)-1-phenylpropyl]benzamide.
| Compound Name | 4-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-[(1S)-1-phenylpropyl]benzamide |
|---|---|
| PubChem CID | 28633363 |
| Molecular Formula | C24H26N2O3S2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 4-[methyl-(4-methylsulfanylphenyl)sulfonylamino]-N-[(1S)-1-phenylpropyl]benzamide |
| SMILES | CC[C@H](NC(=O)c1ccc(N(C)S(=O)(=O)c2ccc(SC)cc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O3S2/c1-4-23(18-8-6-5-7-9-18)25-24(27)19-10-12-20(13-11-19)26(2)31(28,29)22-16-14-21(30-3)15-17-22/h5-17,23H,4H2,1-3H3,(H,25,27)/t23-/m0/s1 |
| InChIKey | BRWLBQXDJOBADT-QHCPKHFHSA-N |
| XLogP | 5.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |