C25H28N2O4S2 — CID 28591644
4-[ethyl-(4-methylsulfanylphenyl)sulfonylamino]-N-(3-propan-2-yloxyphenyl)benzamide (PubChem CID 28591644) has the molecular formula C25H28N2O4S2 and a molecular weight of 484.64 g/mol. Its IUPAC name is 4-[ethyl-(4-methylsulfanylphenyl)sulfonylamino]-N-(3-propan-2-yloxyphenyl)benzamide.
| Compound Name | 4-[ethyl-(4-methylsulfanylphenyl)sulfonylamino]-N-(3-propan-2-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 28591644 |
| Molecular Formula | C25H28N2O4S2 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | 4-[ethyl-(4-methylsulfanylphenyl)sulfonylamino]-N-(3-propan-2-yloxyphenyl)benzamide |
| SMILES | CCN(c1ccc(C(=O)Nc2cccc(OC(C)C)c2)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C25H28N2O4S2/c1-5-27(33(29,30)24-15-13-23(32-4)14-16-24)21-11-9-19(10-12-21)25(28)26-20-7-6-8-22(17-20)31-18(2)3/h6-18H,5H2,1-4H3,(H,26,28) |
| InChIKey | QMTNOYVUSSODGR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |