C21H16ClN3O6S — CID 28592014
2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-(2-methoxy-5-nitrophenyl)acetamide (PubChem CID 28592014) has the molecular formula C21H16ClN3O6S and a molecular weight of 473.89 g/mol. Its IUPAC name is 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-(2-methoxy-5-nitrophenyl)acetamide.
| Compound Name | 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-(2-methoxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 28592014 |
| Molecular Formula | C21H16ClN3O6S |
| Molecular Weight | 473.89 g/mol |
| Exact Mass | 473.04 |
| IUPAC Name | 2-(9-chloro-5,5-dioxobenzo[c][1,2]benzothiazin-6-yl)-N-(2-methoxy-5-nitrophenyl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CN1c2ccc(Cl)cc2-c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C21H16ClN3O6S/c1-31-19-9-7-14(25(27)28)11-17(19)23-21(26)12-24-18-8-6-13(22)10-16(18)15-4-2-3-5-20(15)32(24,29)30/h2-11H,12H2,1H3,(H,23,26) |
| InChIKey | HMOWIYVXQBQQCN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.89 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|