C17H13Cl2N3O4S — CID 28594191
2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide (PubChem CID 28594191) has the molecular formula C17H13Cl2N3O4S and a molecular weight of 426.28 g/mol. Its IUPAC name is 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide.
| Compound Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 28594191 |
| Molecular Formula | C17H13Cl2N3O4S |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 2-(5,6-dichloro-1,3-dioxoisoindol-2-yl)-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
| SMILES | O=C(CN1C(=O)c2cc(Cl)c(Cl)cc2C1=O)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C17H13Cl2N3O4S/c18-12-6-10-11(7-13(12)19)16(25)22(15(10)24)8-14(23)21-17(26)20-4-3-9-2-1-5-27-9/h1-2,5-7H,3-4,8H2,(H2,20,21,23,26) |
| InChIKey | AYLOMSWFDJJAED-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|