C19H18F2N4O4S — CID 24520490
2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-thiophen-2-ylethylcarbamoyl)acetamide (PubChem CID 24520490) has the molecular formula C19H18F2N4O4S and a molecular weight of 436.44 g/mol. Its IUPAC name is 2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-thiophen-2-ylethylcarbamoyl)acetamide.
| Compound Name | 2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 24520490 |
| Molecular Formula | C19H18F2N4O4S |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
| SMILES | CC1(c2ccc(F)c(F)c2)NC(=O)N(CC(=O)NC(=O)NCCc2cccs2)C1=O |
| InChI | InChI=1S/C19H18F2N4O4S/c1-19(11-4-5-13(20)14(21)9-11)16(27)25(18(29)24-19)10-15(26)23-17(28)22-7-6-12-3-2-8-30-12/h2-5,8-9H,6-7,10H2,1H3,(H,24,29)(H2,22,23,26,28) |
| InChIKey | JKWUSPWFVFVLGC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|