C8H15F3N2O — CID 28595908
N-tert-butyl-2-(2,2,2-trifluoroethylamino)acetamide (PubChem CID 28595908) has the molecular formula C8H15F3N2O and a molecular weight of 212.21 g/mol. Its IUPAC name is N-tert-butyl-2-(2,2,2-trifluoroethylamino)acetamide.
| Compound Name | N-tert-butyl-2-(2,2,2-trifluoroethylamino)acetamide |
|---|---|
| PubChem CID | 28595908 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-tert-butyl-2-(2,2,2-trifluoroethylamino)acetamide |
| SMILES | CC(C)(C)NC(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O/c1-7(2,3)13-6(14)4-12-5-8(9,10)11/h12H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | HDIPIHQLFKJSFE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |