C10H7F15N2O — CID 12736424
2-(ethylamino)-3,3,3-trifluoro-N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-2-(trifluoromethyl)propanamide (PubChem CID 12736424) has the molecular formula C10H7F15N2O and a molecular weight of 456.15 g/mol. Its IUPAC name is 2-(ethylamino)-3,3,3-trifluoro-N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-2-(trifluoromethyl)propanamide.
| Compound Name | 2-(ethylamino)-3,3,3-trifluoro-N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 12736424 |
| Molecular Formula | C10H7F15N2O |
| Molecular Weight | 456.15 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 2-(ethylamino)-3,3,3-trifluoro-N-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]-2-(trifluoromethyl)propanamide |
| SMILES | CCNC(C(=O)NC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H7F15N2O/c1-2-26-4(6(11,12)13,7(14,15)16)3(28)27-5(8(17,18)19,9(20,21)22)10(23,24)25/h26H,2H2,1H3,(H,27,28) |
| InChIKey | GHBWIOPPZNNFFP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.15 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |