5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid

C14H12ClNO3 — CID 28605623

IUPAC5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid
SMILESCc1ccc(C)c(Oc2ncc(C(=O)O)cc2Cl)c1
InChIInChI=1S/C14H12ClNO3/c1-8-3-4-9(2)12(5-8)19-13-11(15)6-10(7-16-13)14(17)18/h3-7H,1-2H3,(H,17,18)
InChIKeyFBYLKWLIKSOTKD-UHFFFAOYSA-N
MW277.71 g/mol
LogP3.84
Rot. Bonds3

About 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid

5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid (PubChem CID 28605623) has the molecular formula C14H12ClNO3 and a molecular weight of 277.71 g/mol. Its IUPAC name is 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid.

Molecular Properties

Compound Name5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid
PubChem CID28605623
Molecular FormulaC14H12ClNO3
Molecular Weight277.71 g/mol
Exact Mass277.05
IUPAC Name5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid
SMILESCc1ccc(C)c(Oc2ncc(C(=O)O)cc2Cl)c1
InChIInChI=1S/C14H12ClNO3/c1-8-3-4-9(2)12(5-8)19-13-11(15)6-10(7-16-13)14(17)18/h3-7H,1-2H3,(H,17,18)
InChIKeyFBYLKWLIKSOTKD-UHFFFAOYSA-N
XLogP3.84
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.71
LogP ≤ 53.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid?
The IUPAC name of 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid (CID 28605623) is 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid.
What is the SMILES notation for 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid?
The canonical SMILES for 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid is Cc1ccc(C)c(Oc2ncc(C(=O)O)cc2Cl)c1.
What is the InChIKey of 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid?
The InChIKey is FBYLKWLIKSOTKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNO3/c1-8-3-4-9(2)12(5-8)19-13-11(15)6-10(7-16-13)14(17)18/h3-7H,1-2H3,(H,17,18).
What are the key properties of 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid?
5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid has a molecular weight of 277.71 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-(2,5-dimethylphenoxy)pyridine-3-carboxylic acid is sourced from PubChem (CID 28605623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).