C15H15NO3 — CID 80632032
6-(2,5-dimethylphenoxy)-5-methylpyridine-3-carboxylic acid (PubChem CID 80632032) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 6-(2,5-dimethylphenoxy)-5-methylpyridine-3-carboxylic acid.
| Compound Name | 6-(2,5-dimethylphenoxy)-5-methylpyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 80632032 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 6-(2,5-dimethylphenoxy)-5-methylpyridine-3-carboxylic acid |
| SMILES | Cc1ccc(C)c(Oc2ncc(C(=O)O)cc2C)c1 |
| InChI | InChI=1S/C15H15NO3/c1-9-4-5-10(2)13(6-9)19-14-11(3)7-12(8-16-14)15(17)18/h4-8H,1-3H3,(H,17,18) |
| InChIKey | DFIFPFLMPGYSPS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |