C15H18FN3O2 — CID 28612893
5-[[2-(4-fluorophenyl)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 28612893) has the molecular formula C15H18FN3O2 and a molecular weight of 291.33 g/mol. Its IUPAC name is 5-[[2-(4-fluorophenyl)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[[2-(4-fluorophenyl)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 28612893 |
| Molecular Formula | C15H18FN3O2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 5-[[2-(4-fluorophenyl)ethylamino]methyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | Cn1cc(CNCCc2ccc(F)cc2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H18FN3O2/c1-18-10-12(14(20)19(2)15(18)21)9-17-8-7-11-3-5-13(16)6-4-11/h3-6,10,17H,7-9H2,1-2H3 |
| InChIKey | CMHYBGIUMGMCEG-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|