C14H13N5O2 — CID 28621740
4-[[4-(tetrazol-1-yl)anilino]methyl]benzene-1,3-diol (PubChem CID 28621740) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 4-[[4-(tetrazol-1-yl)anilino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[4-(tetrazol-1-yl)anilino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 28621740 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 4-[[4-(tetrazol-1-yl)anilino]methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNc2ccc(-n3cnnn3)cc2)c(O)c1 |
| InChI | InChI=1S/C14H13N5O2/c20-13-6-1-10(14(21)7-13)8-15-11-2-4-12(5-3-11)19-9-16-17-18-19/h1-7,9,15,20-21H,8H2 |
| InChIKey | DIXFZPLTVXOIKV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|