C13H28N2S — CID 28622139
N,N-dimethyl-1-[(3-methylsulfanylpropylamino)methyl]cyclohexan-1-amine (PubChem CID 28622139) has the molecular formula C13H28N2S and a molecular weight of 244.45 g/mol. Its IUPAC name is N,N-dimethyl-1-[(3-methylsulfanylpropylamino)methyl]cyclohexan-1-amine.
| Compound Name | N,N-dimethyl-1-[(3-methylsulfanylpropylamino)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 28622139 |
| Molecular Formula | C13H28N2S |
| Molecular Weight | 244.45 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | N,N-dimethyl-1-[(3-methylsulfanylpropylamino)methyl]cyclohexan-1-amine |
| SMILES | CSCCCNCC1(N(C)C)CCCCC1 |
| InChI | InChI=1S/C13H28N2S/c1-15(2)13(8-5-4-6-9-13)12-14-10-7-11-16-3/h14H,4-12H2,1-3H3 |
| InChIKey | BXKXNFDLGIHMPA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.45 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|