C15H16Cl2N2O2 — CID 28624007
(3aR,7aS)-2-[(2,4-dichloroanilino)methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 28624007) has the molecular formula C15H16Cl2N2O2 and a molecular weight of 327.21 g/mol. Its IUPAC name is (3aR,7aS)-2-[(2,4-dichloroanilino)methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aS)-2-[(2,4-dichloroanilino)methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 28624007 |
| Molecular Formula | C15H16Cl2N2O2 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (3aR,7aS)-2-[(2,4-dichloroanilino)methyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@H]2CCCC[C@H]2C(=O)N1CNc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl2N2O2/c16-9-5-6-13(12(17)7-9)18-8-19-14(20)10-3-1-2-4-11(10)15(19)21/h5-7,10-11,18H,1-4,8H2/t10-,11+ |
| InChIKey | GBPBZBLLLSCOHI-PHIMTYICSA-N |
| XLogP | 3.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|