C24H23BrN2O3 — CID 28624182
N-[3-[[1-(4-bromophenyl)cyclopentanecarbonyl]amino]-4-methylphenyl]furan-2-carboxamide (PubChem CID 28624182) has the molecular formula C24H23BrN2O3 and a molecular weight of 467.36 g/mol. Its IUPAC name is N-[3-[[1-(4-bromophenyl)cyclopentanecarbonyl]amino]-4-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[1-(4-bromophenyl)cyclopentanecarbonyl]amino]-4-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 28624182 |
| Molecular Formula | C24H23BrN2O3 |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | N-[3-[[1-(4-bromophenyl)cyclopentanecarbonyl]amino]-4-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccco2)cc1NC(=O)C1(c2ccc(Br)cc2)CCCC1 |
| InChI | InChI=1S/C24H23BrN2O3/c1-16-6-11-19(26-22(28)21-5-4-14-30-21)15-20(16)27-23(29)24(12-2-3-13-24)17-7-9-18(25)10-8-17/h4-11,14-15H,2-3,12-13H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | VYUXFIZPLKOZFO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |