C23H25N3O — CID 28631482
(E)-3-(4-tert-butylphenyl)-N-[(2-imidazol-1-ylphenyl)methyl]prop-2-enamide (PubChem CID 28631482) has the molecular formula C23H25N3O and a molecular weight of 359.47 g/mol. Its IUPAC name is (E)-3-(4-tert-butylphenyl)-N-[(2-imidazol-1-ylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(4-tert-butylphenyl)-N-[(2-imidazol-1-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 28631482 |
| Molecular Formula | C23H25N3O |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | (E)-3-(4-tert-butylphenyl)-N-[(2-imidazol-1-ylphenyl)methyl]prop-2-enamide |
| SMILES | CC(C)(C)c1ccc(/C=C/C(=O)NCc2ccccc2-n2ccnc2)cc1 |
| InChI | InChI=1S/C23H25N3O/c1-23(2,3)20-11-8-18(9-12-20)10-13-22(27)25-16-19-6-4-5-7-21(19)26-15-14-24-17-26/h4-15,17H,16H2,1-3H3,(H,25,27)/b13-10+ |
| InChIKey | WVLWQKBXQDLJNN-JLHYYAGUSA-N |
| XLogP | 4.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|