C17H24ClN3O5S — CID 28632153
(2R)-6-chloro-4-methylsulfonyl-N-(3-morpholin-4-ylpropyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 28632153) has the molecular formula C17H24ClN3O5S and a molecular weight of 417.92 g/mol. Its IUPAC name is (2R)-6-chloro-4-methylsulfonyl-N-(3-morpholin-4-ylpropyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2R)-6-chloro-4-methylsulfonyl-N-(3-morpholin-4-ylpropyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 28632153 |
| Molecular Formula | C17H24ClN3O5S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | (2R)-6-chloro-4-methylsulfonyl-N-(3-morpholin-4-ylpropyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CS(=O)(=O)N1C[C@H](C(=O)NCCCN2CCOCC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C17H24ClN3O5S/c1-27(23,24)21-12-16(26-15-4-3-13(18)11-14(15)21)17(22)19-5-2-6-20-7-9-25-10-8-20/h3-4,11,16H,2,5-10,12H2,1H3,(H,19,22)/t16-/m1/s1 |
| InChIKey | OBWOYKYUVCGLDR-MRXNPFEDSA-N |
| XLogP | 0.71 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|