C18H26ClN3O4S — CID 92672811
(2S)-6-chloro-4-methylsulfonyl-N-(3-piperidin-1-ylpropyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 92672811) has the molecular formula C18H26ClN3O4S and a molecular weight of 415.94 g/mol. Its IUPAC name is (2S)-6-chloro-4-methylsulfonyl-N-(3-piperidin-1-ylpropyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | (2S)-6-chloro-4-methylsulfonyl-N-(3-piperidin-1-ylpropyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 92672811 |
| Molecular Formula | C18H26ClN3O4S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | (2S)-6-chloro-4-methylsulfonyl-N-(3-piperidin-1-ylpropyl)-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | CS(=O)(=O)N1C[C@@H](C(=O)NCCCN2CCCCC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H26ClN3O4S/c1-27(24,25)22-13-17(26-16-7-6-14(19)12-15(16)22)18(23)20-8-5-11-21-9-3-2-4-10-21/h6-7,12,17H,2-5,8-11,13H2,1H3,(H,20,23)/t17-/m0/s1 |
| InChIKey | KFGABBRFXCPHBC-KRWDZBQOSA-N |
| XLogP | 1.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|